CAS 951624-06-9 is the registry number for tert-Butyl 2-(3-cyano-4-fluorophenyl)acetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl 2-(3-cyano-4-fluorophenyl)acetate (CAS 951624-06-9) is a chemical compound with the molecular formula C13H14FNO2 and a molecular weight of 235.25 g/mol. IUPAC name: tert-butyl 2-(3-cyano-4-fluorophenyl)acetate. InChIKey: KQFYNURGIZFXQL-UHFFFAOYSA-N.
| Molecular formula | C13H14FNO2 |
|---|---|
| Molecular weight | 235.25 g/mol |
| IUPAC name | tert-butyl 2-(3-cyano-4-fluorophenyl)acetate |
| InChIKey | KQFYNURGIZFXQL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1=CC(=C(C=C1)F)C#N |
Computed by PubChem (NCBI)