cas: 1667-10-3 — see every product listed under this CAS number, including other names
1,1'-Biphenyl, 4,4'-bis(chloromethyl)-, 98%, 98% (CAS 1667-10-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112WWR-10g |
| cas | 1667-10-3 |
| size | 10g |
| availability | 12000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 93.20 Pln | |
| Chemat | 500g | 297.60 Pln | |
| Chemat | 50g | 93.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(chloromethyl)-4-[4-(chloromethyl)phenyl]benzene (CAS 1667-10-3) is a chemical compound with the molecular formula C14H12Cl2 and a molecular weight of 251.1 g/mol. IUPAC name: 1-(chloromethyl)-4-[4-(chloromethyl)phenyl]benzene. InChIKey: INZDTEICWPZYJM-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2 |
|---|---|
| Molecular weight | 251.1 g/mol |
| IUPAC name | 1-(chloromethyl)-4-[4-(chloromethyl)phenyl]benzene |
| InChIKey | INZDTEICWPZYJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCl)C2=CC=C(C=C2)CCl |
Computed by PubChem (NCBI)