CAS 5216-35-3 appears in our catalog under these names: 4,4'-dichlorobibenzyl, 98%, Clobutinol Impurity 4, 1-Chloro-4-(2-(4-chlorophenyl)ethyl)benzene, 4,4'-Dichlorobibenzyl, 4,4'-dichlorobibenzyl, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: 1g, 250mg, on request, 500mg, 5000mg, 100mg.
1-chloro-4-[2-(4-chlorophenyl)ethyl]benzene (CAS 5216-35-3) is a chemical compound with the molecular formula C14H12Cl2 and a molecular weight of 251.1 g/mol. IUPAC name: 1-chloro-4-[2-(4-chlorophenyl)ethyl]benzene. InChIKey: HTHGRQSFMYIQHB-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2 |
|---|---|
| Molecular weight | 251.1 g/mol |
| IUPAC name | 1-chloro-4-[2-(4-chlorophenyl)ethyl]benzene |
| InChIKey | HTHGRQSFMYIQHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCC2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)