Products 77008-64-1
CAS 77008-64-1 is the registry number for 1-Chloro-3-(1-(4-chlorophenyl)ethyl)benzene. Offered by: Mikromol. Available pack sizes: 100mg.
1-chloro-3-[1-(4-chlorophenyl)ethyl]benzene (CAS 77008-64-1) is a chemical compound with the molecular formula C14H12Cl2 and a molecular weight of 251.1 g/mol. IUPAC name: 1-chloro-3-[1-(4-chlorophenyl)ethyl]benzene. InChIKey: RCBXKRCNRRAKLO-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2 |
|---|---|
| Molecular weight | 251.1 g/mol |
| IUPAC name | 1-chloro-3-[1-(4-chlorophenyl)ethyl]benzene |
| InChIKey | RCBXKRCNRRAKLO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Cl)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)