CAS 6639-40-3 is the registry number for 1,2-Bis(o-chlorophenyl)ethane, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-chloro-2-[2-(2-chlorophenyl)ethyl]benzene (CAS 6639-40-3) is a chemical compound with the molecular formula C14H12Cl2 and a molecular weight of 251.1 g/mol. IUPAC name: 1-chloro-2-[2-(2-chlorophenyl)ethyl]benzene. InChIKey: ZVWAKPJYJPOSRT-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2 |
|---|---|
| Molecular weight | 251.1 g/mol |
| IUPAC name | 1-chloro-2-[2-(2-chlorophenyl)ethyl]benzene |
| InChIKey | ZVWAKPJYJPOSRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCC2=CC=CC=C2Cl)Cl |
Computed by PubChem (NCBI)