cas: 115704-83-1 — see every product listed under this CAS number, including other names
1,1,7,7-Tetramethyl-1,2,3,5,6,7-hexahydropyrido[3,2,1-ij]quinolin-8-ol, 98% (CAS 115704-83-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222668-1G |
| cas | 115704-83-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 25g | 383.22 Pln | |
| Fluorochem | 100g | 1158.98 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-6-ol (CAS 115704-83-1) is a chemical compound with the molecular formula C16H23NO and a molecular weight of 245.36 g/mol. IUPAC name: 4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-6-ol. InChIKey: RBFKOHMQYNQBAR-UHFFFAOYSA-N.
| Molecular formula | C16H23NO |
|---|---|
| Molecular weight | 245.36 g/mol |
| IUPAC name | 4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-6-ol |
| InChIKey | RBFKOHMQYNQBAR-UHFFFAOYSA-N |
| SMILES | CC1(CCN2CCC(C3=C(C=CC1=C32)O)(C)C)C |
Computed by PubChem (NCBI)