cas: 1010-26-0 — see every product listed under this CAS number, including other names
1,1-Cyclohexanediacetic Anhydride 98% (CAS 1010-26-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A266618-5g |
| cas | 1010-26-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 381.50 Pln | |
| Ambeed | 500g | 1182.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A266618 |
3-oxaspiro[5.5]undecane-2,4-dione (CAS 1010-26-0) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: 3-oxaspiro[5.5]undecane-2,4-dione. InChIKey: XNDSIASQMRYFSW-UHFFFAOYSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 3-oxaspiro[5.5]undecane-2,4-dione |
| InChIKey | XNDSIASQMRYFSW-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CC(=O)OC(=O)C2 |
Computed by PubChem (NCBI)