cas: 1374666-31-5 — see every product listed under this CAS number, including other names
1,1-Dimethylethyl 3-[2-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethoxy]ethoxy]propanoate, 98%, 98% (CAS 1374666-31-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HV26-100mg |
| cas | 1374666-31-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 966.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate (CAS 1374666-31-5) is a chemical compound with the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. IUPAC name: tert-butyl 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate. InChIKey: XWPBPQDTQUEMBX-UHFFFAOYSA-N.
| Molecular formula | C15H23NO6 |
|---|---|
| Molecular weight | 313.35 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate |
| InChIKey | XWPBPQDTQUEMBX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)