CAS 2518426-66-7 appears in our catalog under these names: Ethyl 3-amino-4,5-bis(2-methoxyethoxy)benzoate, 98%, Benzoic acid， 3-amino-4，5-bis(2-methoxyethoxy)-， ethyl ester, 95%+, 95%+, Benzoic acid, 3-amino-4,5-bis(2-methoxyethoxy)-, ethyl ester, 95%+. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
Ethyl 3-amino-4,5-bis(2-methoxyethoxy)benzoate (CAS 2518426-66-7) is a chemical compound with the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. IUPAC name: ethyl 3-amino-4,5-bis(2-methoxyethoxy)benzoate. InChIKey: RNZMLBGPFACHGW-UHFFFAOYSA-N.
| Molecular formula | C15H23NO6 |
|---|---|
| Molecular weight | 313.35 g/mol |
| IUPAC name | ethyl 3-amino-4,5-bis(2-methoxyethoxy)benzoate |
| InChIKey | RNZMLBGPFACHGW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)OCCOC)OCCOC)N |
Computed by PubChem (NCBI)