Products 2648770-73-2

CAS 2648770-73-2 is the registry number for 11-((2,5-Dioxopyrrolidin-1-yl)oxy)-11-oxoundecanoic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

11-(2,5-dioxopyrrolidin-1-yl)oxy-11-oxoundecanoic acid (CAS 2648770-73-2) is a chemical compound with the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. IUPAC name: 11-(2,5-dioxopyrrolidin-1-yl)oxy-11-oxoundecanoic acid. InChIKey: KJUXODPKWRBCQR-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23NO6
Molecular weight313.35 g/mol
IUPAC name11-(2,5-dioxopyrrolidin-1-yl)oxy-11-oxoundecanoic acid
InChIKeyKJUXODPKWRBCQR-UHFFFAOYSA-N
SMILESC1CC(=O)N(C1=O)OC(=O)CCCCCCCCCC(=O)O

Computed by PubChem (NCBI)