Products 1262964-54-4
CAS 1262964-54-4 is the registry number for 2-(bis(2-(Methacryloyloxy)ethyl)(methyl)ammonio)acetate. Offered by: TRC. Available pack sizes: 750mg.
2-[methyl-bis[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]acetate (CAS 1262964-54-4) is a chemical compound with the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. IUPAC name: 2-[methyl-bis[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]acetate. InChIKey: UDCJNPOOBUHVQF-UHFFFAOYSA-N.
| Molecular formula | C15H23NO6 |
|---|---|
| Molecular weight | 313.35 g/mol |
| IUPAC name | 2-[methyl-bis[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]acetate |
| InChIKey | UDCJNPOOBUHVQF-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC[N+](C)(CCOC(=O)C(=C)C)CC(=O)[O-] |
Computed by PubChem (NCBI)