cas: 77290-31-4 — see every product listed under this CAS number, including other names
1,1-Dimethylethyl 4-(cyanomethyl)-1-piperazinecarboxylate, 96%, 96% (CAS 77290-31-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119NE8-1g |
| cas | 77290-31-4 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 208.40 Pln | |
| Chemat | 25g | 338.00 Pln | |
| Chemat | 100g | 966.80 Pln | |
| Chemat | 50g | 558.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(cyanomethyl)piperazine-1-carboxylate (CAS 77290-31-4) is a chemical compound with the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. IUPAC name: tert-butyl 4-(cyanomethyl)piperazine-1-carboxylate. InChIKey: OJUKCGDZZNLDPC-UHFFFAOYSA-N.
| Molecular formula | C11H19N3O2 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | tert-butyl 4-(cyanomethyl)piperazine-1-carboxylate |
| InChIKey | OJUKCGDZZNLDPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC#N |
Computed by PubChem (NCBI)