cas: 77290-31-4 — see every product listed under this CAS number, including other names
Tert-butyl 4-(cyanomethyl)piperazine-1-carboxylate, 98.99% (CAS 77290-31-4) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 50 g, 5 g, 10 g, 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W046507-1 g |
| cas | 77290-31-4 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 50 g | 1294.93 Pln | |
| MedChemExpress | 5 g | 333.62 Pln | |
| MedChemExpress | 10 g | 477.59 Pln | |
| MedChemExpress | 100 g | 2014.75 Pln | |
| MedChemExpress | 25 g | 839.82 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.99% |
Tert-butyl 4-(cyanomethyl)piperazine-1-carboxylate (CAS 77290-31-4) is a chemical compound with the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. IUPAC name: tert-butyl 4-(cyanomethyl)piperazine-1-carboxylate. InChIKey: OJUKCGDZZNLDPC-UHFFFAOYSA-N.
| Molecular formula | C11H19N3O2 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | tert-butyl 4-(cyanomethyl)piperazine-1-carboxylate |
| InChIKey | OJUKCGDZZNLDPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC#N |
Computed by PubChem (NCBI)