cas: 4199-89-7 — see every product listed under this CAS number, including other names
1,10-Phenanthroline, 5-chloro-, 98%, 98% (CAS 4199-89-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MLK-100mg |
| cas | 4199-89-7 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 10g | 453.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-chloro-1,10-phenanthroline (CAS 4199-89-7) is a chemical compound with the molecular formula C12H7ClN2 and a molecular weight of 214.65 g/mol. IUPAC name: 5-chloro-1,10-phenanthroline. InChIKey: XDUUQOQFSWSZSM-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 5-chloro-1,10-phenanthroline |
| InChIKey | XDUUQOQFSWSZSM-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)Cl |
Computed by PubChem (NCBI)