cas: 4199-89-7 — see every product listed under this CAS number, including other names
5-Chloro-1,10-phenanthroline, >98.0%(T) (CAS 4199-89-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C0786-100MG |
| cas | 4199-89-7 |
| size | 100mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 100mg | 98.68 Pln | |
| TCI | 1g | 477.30 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
5-chloro-1,10-phenanthroline (CAS 4199-89-7) is a chemical compound with the molecular formula C12H7ClN2 and a molecular weight of 214.65 g/mol. IUPAC name: 5-chloro-1,10-phenanthroline. InChIKey: XDUUQOQFSWSZSM-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 5-chloro-1,10-phenanthroline |
| InChIKey | XDUUQOQFSWSZSM-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)Cl |
Computed by PubChem (NCBI)