cas: 4199-89-7 — see every product listed under this CAS number, including other names
5-Chloro-1,10-phenanthroline, 95% (CAS 4199-89-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F340052-1G |
| cas | 4199-89-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 471.73 Pln | |
| Fluorochem | 10g | 883.04 Pln | |
| Fluorochem | 25g | 2028.47 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-chloro-1,10-phenanthroline (CAS 4199-89-7) is a chemical compound with the molecular formula C12H7ClN2 and a molecular weight of 214.65 g/mol. IUPAC name: 5-chloro-1,10-phenanthroline. InChIKey: XDUUQOQFSWSZSM-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 5-chloro-1,10-phenanthroline |
| InChIKey | XDUUQOQFSWSZSM-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)Cl |
Computed by PubChem (NCBI)