cas: 5580-79-0 — see every product listed under this CAS number, including other names
1,2,3,4-Tetrafluoro-5-nitrobenzene, 98%, 98% (CAS 5580-79-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0YF-1g |
| cas | 5580-79-0 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 25g | 304.40 Pln | |
| Chemat | 100g | 1029.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2,3,4-tetrafluoro-5-nitrobenzene (CAS 5580-79-0) is a chemical compound with the molecular formula C6HF4NO2 and a molecular weight of 195.07 g/mol. IUPAC name: 1,2,3,4-tetrafluoro-5-nitrobenzene. InChIKey: MKMDVNZEIQDZEP-UHFFFAOYSA-N.
| Molecular formula | C6HF4NO2 |
|---|---|
| Molecular weight | 195.07 g/mol |
| IUPAC name | 1,2,3,4-tetrafluoro-5-nitrobenzene |
| InChIKey | MKMDVNZEIQDZEP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)