cas: 5580-79-0 — see every product listed under this CAS number, including other names
2,3,4,5-Tetrafluoronitrobenzene, 98% (CAS 5580-79-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007368-5G |
| cas | 5580-79-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 25g | 346.77 Pln | |
| Fluorochem | 100g | 976.76 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,2,3,4-tetrafluoro-5-nitrobenzene (CAS 5580-79-0) is a chemical compound with the molecular formula C6HF4NO2 and a molecular weight of 195.07 g/mol. IUPAC name: 1,2,3,4-tetrafluoro-5-nitrobenzene. InChIKey: MKMDVNZEIQDZEP-UHFFFAOYSA-N.
| Molecular formula | C6HF4NO2 |
|---|---|
| Molecular weight | 195.07 g/mol |
| IUPAC name | 1,2,3,4-tetrafluoro-5-nitrobenzene |
| InChIKey | MKMDVNZEIQDZEP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)