cas: 103733-33-1 — see every product listed under this CAS number, including other names
1,2,3,4-Tetrahydro-isoquinoline-1-carboxylic acidethyl ester hydrochloride, 98% (CAS 103733-33-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040875-250MG |
| cas | 103733-33-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 893.45 Pln | |
| Fluorochem | 5g | 3725.79 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate;hydrochloride (CAS 103733-33-1) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: ethyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate;hydrochloride. InChIKey: LRLJUGFKJBKGTR-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | ethyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate;hydrochloride |
| InChIKey | LRLJUGFKJBKGTR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C2=CC=CC=C2CCN1.Cl |
Computed by PubChem (NCBI)