CAS 193968-71-7 appears in our catalog under these names: 4-(Pyrrolidin-1-ylmethyl)benzoic acid hydrochloride, 95%, 4-Pyrrolidin-1-ylmethyl-benzoic acid hydrochloride, 4-Pyrrolidin-1-ylmethyl-benzoic acid hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 2,5g.
4-(pyrrolidin-1-ylmethyl)benzoic acid;hydrochloride (CAS 193968-71-7) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: 4-(pyrrolidin-1-ylmethyl)benzoic acid;hydrochloride. InChIKey: YVBBCFWJPVGECC-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | 4-(pyrrolidin-1-ylmethyl)benzoic acid;hydrochloride |
| InChIKey | YVBBCFWJPVGECC-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)