Products 193968-71-7

CAS 193968-71-7 appears in our catalog under these names: 4-(Pyrrolidin-1-ylmethyl)benzoic acid hydrochloride, 95%, 4-Pyrrolidin-1-ylmethyl-benzoic acid hydrochloride, 4-Pyrrolidin-1-ylmethyl-benzoic acid hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 2,5g.

Structural formula: {0} (CAS {1})

4-(pyrrolidin-1-ylmethyl)benzoic acid;hydrochloride (CAS 193968-71-7) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: 4-(pyrrolidin-1-ylmethyl)benzoic acid;hydrochloride. InChIKey: YVBBCFWJPVGECC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16ClNO2
Molecular weight241.71 g/mol
IUPAC name4-(pyrrolidin-1-ylmethyl)benzoic acid;hydrochloride
InChIKeyYVBBCFWJPVGECC-UHFFFAOYSA-N
SMILESC1CCN(C1)CC2=CC=C(C=C2)C(=O)O.Cl

Computed by PubChem (NCBI)