CAS 1246509-71-6 appears in our catalog under these names: (R)-Methyl 8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride, 95%, (R)-Methyl 8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl (8R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate;hydrochloride (CAS 1246509-71-6) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: methyl (8R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate;hydrochloride. InChIKey: WHSIBJZKBMEFNO-RFVHGSKJSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | methyl (8R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate;hydrochloride |
| InChIKey | WHSIBJZKBMEFNO-RFVHGSKJSA-N |
| SMILES | COC(=O)C1=CC2=C(CCC[C@H]2N)C=C1.Cl |
Computed by PubChem (NCBI)