CAS 82959-88-4 appears in our catalog under these names: Racemic-(2r,3r)-methyl 2-phenylpyrrolidine-3-carboxylate hydrochloride, 95%, 3–Pyrrolidinecarboxylic acid, 2–phenyl–, Methyl ester, trans–. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
Methyl (2R,3R)-2-phenylpyrrolidine-3-carboxylate;hydrochloride (CAS 82959-88-4) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: methyl (2R,3R)-2-phenylpyrrolidine-3-carboxylate;hydrochloride. InChIKey: RAKLJEPTGBTACR-DHXVBOOMSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | methyl (2R,3R)-2-phenylpyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | RAKLJEPTGBTACR-DHXVBOOMSA-N |
| SMILES | COC(=O)[C@@H]1CCN[C@H]1C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)