cas: 1627563-96-5 — see every product listed under this CAS number, including other names
1,2,3,4-tetrahydroquinoline-6-boronic acid, pinacol ester, 97%, 97% (CAS 1627563-96-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYS5-100mg |
| cas | 1627563-96-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1144.40 Pln | |
| Chemat | 250mg | 1898.00 Pln | |
| Chemat | 1g | 5238.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydroquinoline (CAS 1627563-96-5) is a chemical compound with the molecular formula C15H22BNO2 and a molecular weight of 259.15 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydroquinoline. InChIKey: ISDHEULQJVJXED-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO2 |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydroquinoline |
| InChIKey | ISDHEULQJVJXED-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)NCCC3 |
Computed by PubChem (NCBI)