Products 2223031-12-5
CAS 2223031-12-5 is the registry number for 3-Cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2223031-12-5) is a chemical compound with the molecular formula C15H22BNO2 and a molecular weight of 259.15 g/mol. IUPAC name: 3-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: CCAZCLOHYSBSBX-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO2 |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 3-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | CCAZCLOHYSBSBX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)N)C3CC3 |
Computed by PubChem (NCBI)