Products 2857066-50-1
CAS 2857066-50-1 is the registry number for 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-amine (CAS 2857066-50-1) is a chemical compound with the molecular formula C15H22BNO2 and a molecular weight of 259.15 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-amine. InChIKey: YLGFKKVWXLDGJG-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO2 |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-amine |
| InChIKey | YLGFKKVWXLDGJG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3CCCC3=C(C=C2)N |
Computed by PubChem (NCBI)