Products 2814583-47-4
CAS 2814583-47-4 is the registry number for 6-Methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole (CAS 2814583-47-4) is a chemical compound with the molecular formula C15H22BNO2 and a molecular weight of 259.15 g/mol. IUPAC name: 6-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole. InChIKey: UNIIAWFKYLRNSP-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO2 |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 6-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole |
| InChIKey | UNIIAWFKYLRNSP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC3=C2NCC3)C |
Computed by PubChem (NCBI)