1,2,3,6,7,8-Hexahydropyrene, 98%
cas: 1732-13-4 — see every product listed under this CAS number, including other names
1,2,3,6,7,8-Hexahydropyrene, 98% (CAS 1732-13-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 500mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A984023-250mg |
| cas | 1732-13-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 2689.94 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 500mg | 280.40 Pln | |
| BLDpharm | 250mg | 464.31 Pln | |
| BLDpharm | 1g | 886.38 Pln | |
| BLDpharm | 5g | 2896.78 Pln | |
| Fluorochem | 250mg | 305.12 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1,2,3,6,7,8-hexahydropyrene (CAS 1732-13-4) is a chemical compound with the molecular formula C16H16 and a molecular weight of 208.30 g/mol. IUPAC name: 1,2,3,6,7,8-hexahydropyrene. InChIKey: MBAIEZXRGAOPKH-UHFFFAOYSA-N.
| Molecular formula | C16H16 |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | 1,2,3,6,7,8-hexahydropyrene |
| InChIKey | MBAIEZXRGAOPKH-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=CC=C4C3=C(CCC4)C=C2)C1 |
Computed by PubChem (NCBI)