CAS 1732-13-4 appears in our catalog under these names: 1,2,3,6,7,8-Hexahydropyrene, 95%, 1,2,3,6,7,8-Hexahydropyrene, 1,2,3,6,7,8–Hexahydropyrene, 1,2,3,6,7,8-Hexahydropyrene, >98.0%(GC), 1,2,3,6,7,8-Hexahydropyrene 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 10g, 1g, 5g, 100mg, 500mg, 250mg, 1x50mg.
1,2,3,6,7,8-hexahydropyrene (CAS 1732-13-4) is a chemical compound with the molecular formula C16H16 and a molecular weight of 208.30 g/mol. IUPAC name: 1,2,3,6,7,8-hexahydropyrene. InChIKey: MBAIEZXRGAOPKH-UHFFFAOYSA-N.
| Molecular formula | C16H16 |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | 1,2,3,6,7,8-hexahydropyrene |
| InChIKey | MBAIEZXRGAOPKH-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=CC=C4C3=C(CCC4)C=C2)C1 |
Computed by PubChem (NCBI)