CAS 781-33-9 is the registry number for (2-Methylprop-1-ene-1,1-diyl)dibenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-methyl-1-phenylprop-1-enyl)benzene (CAS 781-33-9) is a chemical compound with the molecular formula C16H16 and a molecular weight of 208.30 g/mol. IUPAC name: (2-methyl-1-phenylprop-1-enyl)benzene. InChIKey: JHLNLKYQTWQERE-UHFFFAOYSA-N.
| Molecular formula | C16H16 |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | (2-methyl-1-phenylprop-1-enyl)benzene |
| InChIKey | JHLNLKYQTWQERE-UHFFFAOYSA-N |
| SMILES | CC(=C(C1=CC=CC=C1)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)