CAS 32812-66-1 is the registry number for 1,1’Cyclobutylidenebis-benzene. Offered by: TRC. Available pack sizes: 100mg.
(1-phenylcyclobutyl)benzene (CAS 32812-66-1) is a chemical compound with the molecular formula C16H16 and a molecular weight of 208.30 g/mol. IUPAC name: (1-phenylcyclobutyl)benzene. InChIKey: RMPAXPOFLJVREM-UHFFFAOYSA-N.
| Molecular formula | C16H16 |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | (1-phenylcyclobutyl)benzene |
| InChIKey | RMPAXPOFLJVREM-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)