cas: 925890-13-7 — see every product listed under this CAS number, including other names
1,2,3-Trifluoro-5-Methoxy-4-Nitrobenzene, 98%, 98% (CAS 925890-13-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GSMA-1g |
| cas | 925890-13-7 |
| size | 1g |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 227.60 Pln | |
| Chemat | 25g | 477.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2,3-trifluoro-5-methoxy-4-nitrobenzene (CAS 925890-13-7) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 1,2,3-trifluoro-5-methoxy-4-nitrobenzene. InChIKey: ZSOYSDLZDZGEFC-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 1,2,3-trifluoro-5-methoxy-4-nitrobenzene |
| InChIKey | ZSOYSDLZDZGEFC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1[N+](=O)[O-])F)F)F |
Computed by PubChem (NCBI)