cas: 925890-13-7 — see every product listed under this CAS number, including other names
1,2,3-Trifluoro-5-methoxy-4-nitrobenzene, 98% (CAS 925890-13-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040571-5G |
| cas | 925890-13-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 232.23 Pln | |
| Fluorochem | 10g | 289.50 Pln | |
| Fluorochem | 25g | 638.33 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,2,3-trifluoro-5-methoxy-4-nitrobenzene (CAS 925890-13-7) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 1,2,3-trifluoro-5-methoxy-4-nitrobenzene. InChIKey: ZSOYSDLZDZGEFC-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 1,2,3-trifluoro-5-methoxy-4-nitrobenzene |
| InChIKey | ZSOYSDLZDZGEFC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1[N+](=O)[O-])F)F)F |
Computed by PubChem (NCBI)