cas: 2465-93-2 — see every product listed under this CAS number, including other names
1,2,3-Tris(2-cyanoethoxy)propane 95% (CAS 2465-93-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A727303-25g |
| cas | 2465-93-2 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 654.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A727303 |
3-[2,3-bis(2-cyanoethoxy)propoxy]propanenitrile (CAS 2465-93-2) is a chemical compound with the molecular formula C12H17N3O3 and a molecular weight of 251.28 g/mol. IUPAC name: 3-[2,3-bis(2-cyanoethoxy)propoxy]propanenitrile. InChIKey: ALGVJKNIAOBBBJ-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O3 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 3-[2,3-bis(2-cyanoethoxy)propoxy]propanenitrile |
| InChIKey | ALGVJKNIAOBBBJ-UHFFFAOYSA-N |
| SMILES | C(COCC(COCCC#N)OCCC#N)C#N |
Computed by PubChem (NCBI)