cas: 703-87-7 — see every product listed under this CAS number, including other names
1,2,4,5-Tetrafluoro-3,6-dimethylbenzene, ≥98%, ≥98% (CAS 703-87-7) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FEV-200mg |
| cas | 703-87-7 |
| size | 200mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 165.20 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 971.60 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
1,2,4,5-tetrafluoro-3,6-dimethylbenzene (CAS 703-87-7) is a chemical compound with the molecular formula C8H6F4 and a molecular weight of 178.13 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3,6-dimethylbenzene. InChIKey: IWKPBYPUIPVYNZ-UHFFFAOYSA-N.
| Molecular formula | C8H6F4 |
|---|---|
| Molecular weight | 178.13 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3,6-dimethylbenzene |
| InChIKey | IWKPBYPUIPVYNZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1F)F)C)F)F |
Computed by PubChem (NCBI)