CAS 80245-26-7 appears in our catalog under these names: 4-Fluoro-2-methylbenzotrifluoride, 95%, 4-Fluoro-2-methyl-1-trifluoromethyl-benzene, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g.
4-fluoro-2-methyl-1-(trifluoromethyl)benzene (CAS 80245-26-7) is a chemical compound with the molecular formula C8H6F4 and a molecular weight of 178.13 g/mol. IUPAC name: 4-fluoro-2-methyl-1-(trifluoromethyl)benzene. InChIKey: XBUKSKTZQURUDT-UHFFFAOYSA-N.
| Molecular formula | C8H6F4 |
|---|---|
| Molecular weight | 178.13 g/mol |
| IUPAC name | 4-fluoro-2-methyl-1-(trifluoromethyl)benzene |
| InChIKey | XBUKSKTZQURUDT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)C(F)(F)F |
Computed by PubChem (NCBI)