CAS 93524-64-2 is the registry number for 1-Fluoro-2-(2,2,2-trifluoroethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 250mg, 1g.
1-fluoro-2-(2,2,2-trifluoroethyl)benzene (CAS 93524-64-2) is a chemical compound with the molecular formula C8H6F4 and a molecular weight of 178.13 g/mol. IUPAC name: 1-fluoro-2-(2,2,2-trifluoroethyl)benzene. InChIKey: SPXLMKIFMUHCGI-UHFFFAOYSA-N.
| Molecular formula | C8H6F4 |
|---|---|
| Molecular weight | 178.13 g/mol |
| IUPAC name | 1-fluoro-2-(2,2,2-trifluoroethyl)benzene |
| InChIKey | SPXLMKIFMUHCGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(F)(F)F)F |
Computed by PubChem (NCBI)