CAS 703-87-7 appears in our catalog under these names: 2,3,5,6-Tetrafluoro-p-xylene, 95%, 2,3,5,6–Tetrafluoro–p–xylene, 2,3,5,6-Tetrafluoro-p-xylene, >98.0%(GC), 1,2,4,5-Tetrafluoro-3,6-dimethylbenzene, ≥98%, ≥98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 200mg, 250mg.
1,2,4,5-tetrafluoro-3,6-dimethylbenzene (CAS 703-87-7) is a chemical compound with the molecular formula C8H6F4 and a molecular weight of 178.13 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3,6-dimethylbenzene. InChIKey: IWKPBYPUIPVYNZ-UHFFFAOYSA-N.
| Molecular formula | C8H6F4 |
|---|---|
| Molecular weight | 178.13 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3,6-dimethylbenzene |
| InChIKey | IWKPBYPUIPVYNZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1F)F)C)F)F |
Computed by PubChem (NCBI)