cas: 5463-22-9 — see every product listed under this CAS number, including other names
1,2-Bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione, 95% (CAS 5463-22-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F754541-25MG |
| cas | 5463-22-9 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 981.96 Pln | |
| Fluorochem | 100mg | 2814.65 Pln | |
| Fluorochem | 250mg | 6349.87 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1,2-bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione (CAS 5463-22-9) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: 1,2-bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione. InChIKey: MJHMXBDRUWSJOS-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | 1,2-bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione |
| InChIKey | MJHMXBDRUWSJOS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)C(=O)C2=CC(=C(C=C2)O)OC)O |
Computed by PubChem (NCBI)