CAS 861600-12-6 is the registry number for 3,3'-Dimethoxy-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-carboxy-3-methoxyphenyl)-2-methoxybenzoic acid (CAS 861600-12-6) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: 4-(4-carboxy-3-methoxyphenyl)-2-methoxybenzoic acid. InChIKey: OTRGXSFRJBUHRJ-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | 4-(4-carboxy-3-methoxyphenyl)-2-methoxybenzoic acid |
| InChIKey | OTRGXSFRJBUHRJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=CC(=C(C=C2)C(=O)O)OC)C(=O)O |
Computed by PubChem (NCBI)