Products 861600-12-6

CAS 861600-12-6 is the registry number for 3,3'-Dimethoxy-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(4-carboxy-3-methoxyphenyl)-2-methoxybenzoic acid (CAS 861600-12-6) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: 4-(4-carboxy-3-methoxyphenyl)-2-methoxybenzoic acid. InChIKey: OTRGXSFRJBUHRJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14O6
Molecular weight302.28 g/mol
IUPAC name4-(4-carboxy-3-methoxyphenyl)-2-methoxybenzoic acid
InChIKeyOTRGXSFRJBUHRJ-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C2=CC(=C(C=C2)C(=O)O)OC)C(=O)O

Computed by PubChem (NCBI)