CAS 288154-70-1 is the registry number for Dimethyl 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Dimethyl 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate (CAS 288154-70-1) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: dimethyl 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate. InChIKey: BBHYQYNYQCHBGP-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | dimethyl 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate |
| InChIKey | BBHYQYNYQCHBGP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC3=C(C=C2O1)C(=C(O3)C)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)