CAS 5463-22-9 appears in our catalog under these names: Ethanedione, bis(4-hydroxy-3-methoxyphenyl)-, 95%, 1,2–bis(4–hydroxy–3–methoxyphenyl)ethane–1,2–dione, ETHANEDIONE, BIS(4-HYDROXY-3-METHOXYPHENYL)-, 95%, 95%, 1,2-Bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 25mg.
1,2-bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione (CAS 5463-22-9) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: 1,2-bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione. InChIKey: MJHMXBDRUWSJOS-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | 1,2-bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione |
| InChIKey | MJHMXBDRUWSJOS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)C(=O)C2=CC(=C(C=C2)O)OC)O |
Computed by PubChem (NCBI)