cas: 433-95-4 — see every product listed under this CAS number, including other names
1,2-Bis(Trifluoromethyl)benzene (CAS 433-95-4) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034743-5G |
| cas | 433-95-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 351.98 Pln |
| delivery time | 2-3 weeks |
|---|
1,2-bis(trifluoromethyl)benzene (CAS 433-95-4) is a chemical compound with the molecular formula C8H4F6 and a molecular weight of 214.11 g/mol. IUPAC name: 1,2-bis(trifluoromethyl)benzene. InChIKey: XXZOEDQFGXTEAD-UHFFFAOYSA-N.
| Molecular formula | C8H4F6 |
|---|---|
| Molecular weight | 214.11 g/mol |
| IUPAC name | 1,2-bis(trifluoromethyl)benzene |
| InChIKey | XXZOEDQFGXTEAD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)