cas: 433-95-4 — see every product listed under this CAS number, including other names
1,2-Bis(trifluoromethyl)benzene 98% (CAS 433-95-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A746732-1g |
| cas | 433-95-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 492.75 Pln | |
| Ambeed | 10g | 909.94 Pln | |
| Ambeed | 25g | 1916.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A746732 |
1,2-bis(trifluoromethyl)benzene (CAS 433-95-4) is a chemical compound with the molecular formula C8H4F6 and a molecular weight of 214.11 g/mol. IUPAC name: 1,2-bis(trifluoromethyl)benzene. InChIKey: XXZOEDQFGXTEAD-UHFFFAOYSA-N.
| Molecular formula | C8H4F6 |
|---|---|
| Molecular weight | 214.11 g/mol |
| IUPAC name | 1,2-bis(trifluoromethyl)benzene |
| InChIKey | XXZOEDQFGXTEAD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)