cas: 52411-34-4 — see every product listed under this CAS number, including other names
1,2-Bis(o-aminophenoxy)ethane, 97%, 97% (CAS 52411-34-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g, 75g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0DN-1g |
| cas | 52411-34-4 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 270.80 Pln | |
| Chemat | 50g | 198.80 Pln | |
| Chemat | 75g | 261.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[2-(2-aminophenoxy)ethoxy]aniline (CAS 52411-34-4) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: 2-[2-(2-aminophenoxy)ethoxy]aniline. InChIKey: PSDFQEVOCCOOET-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 2-[2-(2-aminophenoxy)ethoxy]aniline |
| InChIKey | PSDFQEVOCCOOET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)OCCOC2=CC=CC=C2N |
Computed by PubChem (NCBI)