cas: 52411-34-4 — see every product listed under this CAS number, including other names
Ethylene Glycol Bis(2-aminophenyl) Ether, >98.0%(HPLC)(T) (CAS 52411-34-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | E1365-1G |
| cas | 52411-34-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 162.60 Pln | |
| TCI | 5g | 492.06 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
2-[2-(2-aminophenoxy)ethoxy]aniline (CAS 52411-34-4) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: 2-[2-(2-aminophenoxy)ethoxy]aniline. InChIKey: PSDFQEVOCCOOET-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 2-[2-(2-aminophenoxy)ethoxy]aniline |
| InChIKey | PSDFQEVOCCOOET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)OCCOC2=CC=CC=C2N |
Computed by PubChem (NCBI)