1,2-Di-m-tolylethyne, 98%
cas: 2765-16-4 — see every product listed under this CAS number, including other names
1,2-Di-m-tolylethyne, 98% (CAS 2765-16-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1353552-100mg |
| cas | 2765-16-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 559.50 Pln | |
| Ambeed | 250mg | 904.38 Pln | |
| Ambeed | 1g | 2317.25 Pln | |
| BLDpharm | 100mg | 553.16 Pln | |
| BLDpharm | 250mg | 891.93 Pln | |
| BLDpharm | 1g | 2274.78 Pln | |
| Chemat | 100mg | 506.00 Pln | |
| Chemat | 250mg | 808.40 Pln | |
| Chemat | 1g | 2070.80 Pln | |
| Fluorochem | 250mg | 883.04 Pln | |
| Fluorochem | 1g | 2205.49 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-methyl-3-[2-(3-methylphenyl)ethynyl]benzene (CAS 2765-16-4) is a chemical compound with the molecular formula C16H14 and a molecular weight of 206.28 g/mol. IUPAC name: 1-methyl-3-[2-(3-methylphenyl)ethynyl]benzene. InChIKey: VWGHYYQMOXOCCI-UHFFFAOYSA-N.
| Molecular formula | C16H14 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 1-methyl-3-[2-(3-methylphenyl)ethynyl]benzene |
| InChIKey | VWGHYYQMOXOCCI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C#CC2=CC=CC(=C2)C |
Computed by PubChem (NCBI)