CAS 3674-74-6 appears in our catalog under these names: 2-Ethylphenanthrene, 95%, 2-ETHYLPHENANTHRENE, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
2-ethylphenanthrene (CAS 3674-74-6) is a chemical compound with the molecular formula C16H14 and a molecular weight of 206.28 g/mol. IUPAC name: 2-ethylphenanthrene. InChIKey: UMAHMIHRNVICDZ-UHFFFAOYSA-N.
| Molecular formula | C16H14 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 2-ethylphenanthrene |
| InChIKey | UMAHMIHRNVICDZ-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)C3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)