CAS 781-17-9 appears in our catalog under these names: 4,5,9,10-Tetrahydropyrene, 95%, 4,5,9,10–Tetrahydropyrene, 4,5,9,10-Tetrahydropyrene, >98.0%(GC), 4,5,9,10-Tetrahydropyrene (purified by sublimation), >98.0%(GC), 4,5,9,10-Tetrahydropyrene, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
4,5,9,10-tetrahydropyrene (CAS 781-17-9) is a chemical compound with the molecular formula C16H14 and a molecular weight of 206.28 g/mol. IUPAC name: 4,5,9,10-tetrahydropyrene. InChIKey: XDFUNRTWHPWCKO-UHFFFAOYSA-N.
| Molecular formula | C16H14 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 4,5,9,10-tetrahydropyrene |
| InChIKey | XDFUNRTWHPWCKO-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=CC=C2)CCC4=CC=CC1=C43 |
Computed by PubChem (NCBI)