CAS 153733-75-6 appears in our catalog under these names: 2-Methyl-7-phenyl-1h-indene, 95%, 2-Methyl-7-phenyl-1H-indene, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-methyl-7-phenyl-1H-indene (CAS 153733-75-6) is a chemical compound with the molecular formula C16H14 and a molecular weight of 206.28 g/mol. IUPAC name: 2-methyl-7-phenyl-1H-indene. InChIKey: JQCCMEDYANGBOG-UHFFFAOYSA-N.
| Molecular formula | C16H14 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 2-methyl-7-phenyl-1H-indene |
| InChIKey | JQCCMEDYANGBOG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C1)C(=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)