1,2-Diamino-4,5-dimethoxybenzene HCl 98%
cas: 131076-14-7 — see every product listed under this CAS number, including other names
1,2-Diamino-4,5-dimethoxybenzene HCl 98% (CAS 131076-14-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A473564-100mg |
| cas | 131076-14-7 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 1616.38 Pln | |
| Ambeed | 10g | 2634.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A473564 |
4,5-dimethoxybenzene-1,2-diamine;dihydrochloride (CAS 131076-14-7) is a chemical compound with the molecular formula C8H14Cl2N2O2 and a molecular weight of 241.11 g/mol. IUPAC name: 4,5-dimethoxybenzene-1,2-diamine;dihydrochloride. InChIKey: ORAAOAMEUMZGGU-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 4,5-dimethoxybenzene-1,2-diamine;dihydrochloride |
| InChIKey | ORAAOAMEUMZGGU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)N)OC.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
4,5-Dimethoxybenzene-1,2-diamine--hydrogen chloride (1/2), 4,5-dimethoxybenzene-1,2-diamine dihydrochloride, 4,5-dimethoxybenzene-1,2-diamine;dihydrochloride, 1,2-Benzenediamine, 4,5-dimethoxy-, dihydrochloride, 4,5-dimethoxybenzene-1,2-diamine 2HCl, dihydrochlo, 4,5-dimethoxybenzene-1,2-diamine, chloride, chloride, 4,5-Dimethoxy-o-phenylenediamine dihydrochloride, 4,5-dimethoxybenzene-1,2-diamine,dihydrochloride, 1,2-Diamino-4,5-dimethoxybenzene (hydrochloride)